C21H25NO3S — CID 147544327
methyl 2-[7-(2-aminophenyl)-6-oxoheptyl]sulfanylbenzoate (PubChem CID 147544327) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl 2-[7-(2-aminophenyl)-6-oxoheptyl]sulfanylbenzoate.
| Compound Name | methyl 2-[7-(2-aminophenyl)-6-oxoheptyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 147544327 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 2-[7-(2-aminophenyl)-6-oxoheptyl]sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1SCCCCCC(=O)Cc1ccccc1N |
| InChI | InChI=1S/C21H25NO3S/c1-25-21(24)18-11-5-7-13-20(18)26-14-8-2-3-10-17(23)15-16-9-4-6-12-19(16)22/h4-7,9,11-13H,2-3,8,10,14-15,22H2,1H3 |
| InChIKey | FPNKVHRSHQFYLM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|