C18H20O2S — CID 22592992
methyl 2-[(2,4,6-trimethylphenyl)methylsulfanyl]benzoate (PubChem CID 22592992) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is methyl 2-[(2,4,6-trimethylphenyl)methylsulfanyl]benzoate.
| Compound Name | methyl 2-[(2,4,6-trimethylphenyl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 22592992 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 2-[(2,4,6-trimethylphenyl)methylsulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1SCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H20O2S/c1-12-9-13(2)16(14(3)10-12)11-21-17-8-6-5-7-15(17)18(19)20-4/h5-10H,11H2,1-4H3 |
| InChIKey | UGXHCTZDHUTDGG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |