C19H20O3S — CID 67827577
methyl 2-[2-[(2,6-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoate (PubChem CID 67827577) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is methyl 2-[2-[(2,6-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoate.
| Compound Name | methyl 2-[2-[(2,6-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 67827577 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 2-[2-[(2,6-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoate |
| SMILES | COC(=O)C(=CO)c1ccccc1SCc1c(C)cccc1C |
| InChI | InChI=1S/C19H20O3S/c1-13-7-6-8-14(2)17(13)12-23-18-10-5-4-9-15(18)16(11-20)19(21)22-3/h4-11,20H,12H2,1-3H3 |
| InChIKey | QXGNXSIIGMMANT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|