C46H28N4O2 — CID 147547147
2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-1,3-benzoxazole (PubChem CID 147547147) has the molecular formula C46H28N4O2 and a molecular weight of 668.76 g/mol. Its IUPAC name is 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 147547147 |
| Molecular Formula | C46H28N4O2 |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 2-[9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc5oc6c(-c7nc8ccccc8o7)cccc6c45)n3)cc2)cc1 |
| InChI | InChI=1S/C46H28N4O2/c1-3-11-29(12-4-1)31-21-25-33(26-22-31)43-48-44(34-27-23-32(24-28-34)30-13-5-2-6-14-30)50-45(49-43)36-16-10-20-40-41(36)35-15-9-17-37(42(35)51-40)46-47-38-18-7-8-19-39(38)52-46/h1-28H |
| InChIKey | FQBCFFRQAUFBFY-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |