C34H20N4OS — CID 147569754
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-1,3-benzoxazole (PubChem CID 147569754) has the molecular formula C34H20N4OS and a molecular weight of 532.63 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 147569754 |
| Molecular Formula | C34H20N4OS |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4sc5cccc(-c6nc7ccccc7o6)c5c34)n2)cc1 |
| InChI | InChI=1S/C34H20N4OS/c1-3-11-21(12-4-1)31-36-32(22-13-5-2-6-14-22)38-33(37-31)23-15-9-19-27-29(23)30-24(16-10-20-28(30)40-27)34-35-25-17-7-8-18-26(25)39-34/h1-20H |
| InChIKey | FUGVBPAFRUKLAF-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |