C41H25N3OS — CID 146955128
2-[9-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole (PubChem CID 146955128) has the molecular formula C41H25N3OS and a molecular weight of 607.74 g/mol. Its IUPAC name is 2-[9-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 146955128 |
| Molecular Formula | C41H25N3OS |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 2-[9-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccccc4)nc(-c4cccc5sc6c(-c7nc8ccccc8o7)cccc6c45)n3)cc2)cc1 |
| InChI | InChI=1S/C41H25N3OS/c1-3-11-26(12-4-1)27-21-23-29(24-22-27)35-25-34(28-13-5-2-6-14-28)42-40(43-35)31-16-10-20-37-38(31)30-15-9-17-32(39(30)46-37)41-44-33-18-7-8-19-36(33)45-41/h1-25H |
| InChIKey | AJMDYJMAGGUDNE-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |