C47H30N4OS — CID 167250347
2-[9-[4-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole (PubChem CID 167250347) has the molecular formula C47H30N4OS and a molecular weight of 698.85 g/mol. Its IUPAC name is 2-[9-[4-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-[4-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 167250347 |
| Molecular Formula | C47H30N4OS |
| Molecular Weight | 698.85 g/mol |
| Exact Mass | 698.21 |
| IUPAC Name | 2-[9-[4-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]-1,3-benzoxazole |
| SMILES | C#C/C=C\C(=C/C)c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cccc4sc5c(-c6nc7ccccc7o6)cccc5c34)n2)cc1 |
| InChI | InChI=1S/C47H30N4OS/c1-3-5-13-30(4-2)32-22-26-34(27-23-32)44-49-45(35-28-24-33(25-29-35)31-14-7-6-8-15-31)51-46(50-44)37-17-12-21-41-42(37)36-16-11-18-38(43(36)53-41)47-48-39-19-9-10-20-40(39)52-47/h1,4-29H,2H3/b13-5-,30-4+ |
| InChIKey | ATPGQPGBZVSSFR-AMLJRJIJSA-N |
| XLogP | 12.31 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.85 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|