C24H38O4 — CID 14756344
[(2E,6E,10E)-3-(acetyloxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 14756344) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(2E,6E,10E)-3-(acetyloxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [(2E,6E,10E)-3-(acetyloxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 14756344 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(2E,6E,10E)-3-(acetyloxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OC/C=C(\CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)COC(C)=O |
| InChI | InChI=1S/C24H38O4/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-24(18-28-23(6)26)16-17-27-22(5)25/h10,12,14,16H,7-9,11,13,15,17-18H2,1-6H3/b20-12+,21-14+,24-16+ |
| InChIKey | BXHWJMFMIATBQR-VFEUGKPNSA-N |
| XLogP | 6.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|