C24H26FN3O2 — CID 147568073
azepan-1-yl-[4-[2-(6-ethylimidazo[1,2-a]pyridin-3-yl)oxiran-2-yl]-3-fluorophenyl]methanone (PubChem CID 147568073) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is azepan-1-yl-[4-[2-(6-ethylimidazo[1,2-a]pyridin-3-yl)oxiran-2-yl]-3-fluorophenyl]methanone.
| Compound Name | azepan-1-yl-[4-[2-(6-ethylimidazo[1,2-a]pyridin-3-yl)oxiran-2-yl]-3-fluorophenyl]methanone |
|---|---|
| PubChem CID | 147568073 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | azepan-1-yl-[4-[2-(6-ethylimidazo[1,2-a]pyridin-3-yl)oxiran-2-yl]-3-fluorophenyl]methanone |
| SMILES | CCc1ccc2ncc(C3(c4ccc(C(=O)N5CCCCCC5)cc4F)CO3)n2c1 |
| InChI | InChI=1S/C24H26FN3O2/c1-2-17-7-10-22-26-14-21(28(22)15-17)24(16-30-24)19-9-8-18(13-20(19)25)23(29)27-11-5-3-4-6-12-27/h7-10,13-15H,2-6,11-12,16H2,1H3 |
| InChIKey | FTYUWEHHFIJTDT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|