C17H29NO — CID 147568445
4-cyclopropyl-N-[2-(4-methoxy-6-methylcyclohexa-1,3-dien-1-yl)ethyl]butan-1-amine (PubChem CID 147568445) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4-cyclopropyl-N-[2-(4-methoxy-6-methylcyclohexa-1,3-dien-1-yl)ethyl]butan-1-amine.
| Compound Name | 4-cyclopropyl-N-[2-(4-methoxy-6-methylcyclohexa-1,3-dien-1-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 147568445 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-cyclopropyl-N-[2-(4-methoxy-6-methylcyclohexa-1,3-dien-1-yl)ethyl]butan-1-amine |
| SMILES | COC1=CC=C(CCNCCCCC2CC2)C(C)C1 |
| InChI | InChI=1S/C17H29NO/c1-14-13-17(19-2)9-8-16(14)10-12-18-11-4-3-5-15-6-7-15/h8-9,14-15,18H,3-7,10-13H2,1-2H3 |
| InChIKey | FUAPARMUYSZSBT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|