C10H9O2S- — CID 147568847
3,4-dihydronaphthalene-2-sulfinate (PubChem CID 147568847) has the molecular formula C10H9O2S- and a molecular weight of 193.25 g/mol. Its IUPAC name is 3,4-dihydronaphthalene-2-sulfinate.
| Compound Name | 3,4-dihydronaphthalene-2-sulfinate |
|---|---|
| PubChem CID | 147568847 |
| Molecular Formula | C10H9O2S- |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 3,4-dihydronaphthalene-2-sulfinate |
| SMILES | O=S([O-])C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C10H10O2S/c11-13(12)10-6-5-8-3-1-2-4-9(8)7-10/h1-4,7H,5-6H2,(H,11,12)/p-1 |
| InChIKey | YGXTYKGFPCLMQY-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|