C23H27N5O — CID 147575403
(4R)-6-[7-(1-amino-3-methyliminoprop-1-en-2-yl)-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 147575403) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is (4R)-6-[7-(1-amino-3-methyliminoprop-1-en-2-yl)-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[7-(1-amino-3-methyliminoprop-1-en-2-yl)-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 147575403 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (4R)-6-[7-(1-amino-3-methyliminoprop-1-en-2-yl)-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/N=C/C(=CN)c1ccc2c(c1)N(c1cccc3c1N[C@H](C)CC(=O)N3)CCC2 |
| InChI | InChI=1S/C23H27N5O/c1-15-11-22(29)27-19-6-3-7-20(23(19)26-15)28-10-4-5-16-8-9-17(12-21(16)28)18(13-24)14-25-2/h3,6-9,12-15,26H,4-5,10-11,24H2,1-2H3,(H,27,29)/b18-13?,25-14+/t15-/m1/s1 |
| InChIKey | GYYILDNEHHUTPX-FXAXKEROSA-N |
| XLogP | 3.91 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|