C18H16N2O6S — CID 147575662
methyl 2-[1-(2-methoxyethoxycarbonyl)indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 147575662) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is methyl 2-[1-(2-methoxyethoxycarbonyl)indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-(2-methoxyethoxycarbonyl)indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 147575662 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | methyl 2-[1-(2-methoxyethoxycarbonyl)indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOC(=O)n1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccccc21 |
| InChI | InChI=1S/C18H16N2O6S/c1-24-7-8-26-18(23)20-9-12(11-5-3-4-6-14(11)20)15(21)16-19-13(10-27-16)17(22)25-2/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | FVKOPKFDAALNPQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|