C23H29ClN2O2 — CID 147585859
1-[(2S)-2-[(3-acetyl-4-chloroindol-1-yl)methyl]pyrrolidin-1-yl]-2-cyclohexylethanone (PubChem CID 147585859) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-[(2S)-2-[(3-acetyl-4-chloroindol-1-yl)methyl]pyrrolidin-1-yl]-2-cyclohexylethanone.
| Compound Name | 1-[(2S)-2-[(3-acetyl-4-chloroindol-1-yl)methyl]pyrrolidin-1-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 147585859 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[(2S)-2-[(3-acetyl-4-chloroindol-1-yl)methyl]pyrrolidin-1-yl]-2-cyclohexylethanone |
| SMILES | CC(=O)c1cn(C[C@@H]2CCCN2C(=O)CC2CCCCC2)c2cccc(Cl)c12 |
| InChI | InChI=1S/C23H29ClN2O2/c1-16(27)19-15-25(21-11-5-10-20(24)23(19)21)14-18-9-6-12-26(18)22(28)13-17-7-3-2-4-8-17/h5,10-11,15,17-18H,2-4,6-9,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | FXHXSJSZJTYVER-SFHVURJKSA-N |
| XLogP | 5.46 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |