C21H27ClN2O2 — CID 71077819
N-[4-chloro-1-(oxetan-3-ylmethyl)indol-3-yl]-2-cycloheptylacetamide (PubChem CID 71077819) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-[4-chloro-1-(oxetan-3-ylmethyl)indol-3-yl]-2-cycloheptylacetamide.
| Compound Name | N-[4-chloro-1-(oxetan-3-ylmethyl)indol-3-yl]-2-cycloheptylacetamide |
|---|---|
| PubChem CID | 71077819 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[4-chloro-1-(oxetan-3-ylmethyl)indol-3-yl]-2-cycloheptylacetamide |
| SMILES | O=C(CC1CCCCCC1)Nc1cn(CC2COC2)c2cccc(Cl)c12 |
| InChI | InChI=1S/C21H27ClN2O2/c22-17-8-5-9-19-21(17)18(12-24(19)11-16-13-26-14-16)23-20(25)10-15-6-3-1-2-4-7-15/h5,8-9,12,15-16H,1-4,6-7,10-11,13-14H2,(H,23,25) |
| InChIKey | OABOBHHBRBXVKJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |