C20H27ClN2O3 — CID 46940506
N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-3-cyclohexylpropanamide (PubChem CID 46940506) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 46940506 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1cn(C(CO)CO)c2cccc(Cl)c12 |
| InChI | InChI=1S/C20H27ClN2O3/c21-16-7-4-8-18-20(16)17(11-23(18)15(12-24)13-25)22-19(26)10-9-14-5-2-1-3-6-14/h4,7-8,11,14-15,24-25H,1-3,5-6,9-10,12-13H2,(H,22,26) |
| InChIKey | CVXARHQUPAZUEY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |