C19H25ClN2O3 — CID 46940421
N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-2-cyclohexylacetamide (PubChem CID 46940421) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-2-cyclohexylacetamide.
| Compound Name | N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 46940421 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[4-chloro-1-(1,3-dihydroxypropan-2-yl)indol-3-yl]-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)Nc1cn(C(CO)CO)c2cccc(Cl)c12 |
| InChI | InChI=1S/C19H25ClN2O3/c20-15-7-4-8-17-19(15)16(10-22(17)14(11-23)12-24)21-18(25)9-13-5-2-1-3-6-13/h4,7-8,10,13-14,23-24H,1-3,5-6,9,11-12H2,(H,21,25) |
| InChIKey | HIIVSNPXBZCNEN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |