C20H25BN2O3 — CID 89283785
CID 89283785 (PubChem CID 89283785) has the molecular formula C20H25BN2O3 and a molecular weight of 352.24 g/mol.
| Compound Name | CID 89283785 |
|---|---|
| PubChem CID | 89283785 |
| Molecular Formula | C20H25BN2O3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1c(NC(=O)CC1CCCCC1)cn2CC1(O)COC1 |
| InChI | InChI=1S/C20H25BN2O3/c21-15-7-4-8-17-19(15)16(10-23(17)11-20(25)12-26-13-20)22-18(24)9-14-5-2-1-3-6-14/h4,7-8,10,14,25H,1-3,5-6,9,11-13H2,(H,22,24) |
| InChIKey | LCLCWGFOCPROPQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|