About 2-oxoethyl propanoate
2-oxoethyl propanoate (PubChem CID 14759390) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is 2-oxoethyl propanoate.
Molecular Properties
| Compound Name | 2-oxoethyl propanoate |
| PubChem CID | 14759390 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 2-oxoethyl propanoate |
| SMILES | CCC(=O)OCC=O |
| InChI | InChI=1S/C5H8O3/c1-2-5(7)8-4-3-6/h3H,2,4H2,1H3 |
| InChIKey | YEBVXYOFWKIFLE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl propanoate?
The IUPAC name of 2-oxoethyl propanoate (CID 14759390) is 2-oxoethyl propanoate.
What is the SMILES notation for 2-oxoethyl propanoate?
The canonical SMILES for 2-oxoethyl propanoate is CCC(=O)OCC=O.
What is the InChIKey of 2-oxoethyl propanoate?
The InChIKey is YEBVXYOFWKIFLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-5(7)8-4-3-6/h3H,2,4H2,1H3.
What are the key properties of 2-oxoethyl propanoate?
2-oxoethyl propanoate has a molecular weight of 116.12 g/mol, XLogP of 0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl propanoate is sourced from PubChem (CID 14759390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).