C23H19ClN2O7 — CID 147601345
4-[3-[4-(5-chloro-2-nitrophenyl)-5-methoxy-2-oxo-1-pyridinyl]-2-oxobutyl]benzoic acid (PubChem CID 147601345) has the molecular formula C23H19ClN2O7 and a molecular weight of 470.87 g/mol. Its IUPAC name is 4-[3-[4-(5-chloro-2-nitrophenyl)-5-methoxy-2-oxo-1-pyridinyl]-2-oxobutyl]benzoic acid.
| Compound Name | 4-[3-[4-(5-chloro-2-nitrophenyl)-5-methoxy-2-oxo-1-pyridinyl]-2-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 147601345 |
| Molecular Formula | C23H19ClN2O7 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 4-[3-[4-(5-chloro-2-nitrophenyl)-5-methoxy-2-oxo-1-pyridinyl]-2-oxobutyl]benzoic acid |
| SMILES | COc1cn(C(C)C(=O)Cc2ccc(C(=O)O)cc2)c(=O)cc1-c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19ClN2O7/c1-13(20(27)9-14-3-5-15(6-4-14)23(29)30)25-12-21(33-2)18(11-22(25)28)17-10-16(24)7-8-19(17)26(31)32/h3-8,10-13H,9H2,1-2H3,(H,29,30) |
| InChIKey | GAEYGKSFQXLVIY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|