C31H26ClNO6 — CID 147961611
4-[(3R)-3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4,4-dideuterio-2-oxo-4-(2,3,4,5,6-pentadeuteriophenyl)butyl]benzoic acid (PubChem CID 147961611) has the molecular formula C31H26ClNO6 and a molecular weight of 551.05 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4,4-dideuterio-2-oxo-4-(2,3,4,5,6-pentadeuteriophenyl)butyl]benzoic acid.
| Compound Name | 4-[(3R)-3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4,4-dideuterio-2-oxo-4-(2,3,4,5,6-pentadeuteriophenyl)butyl]benzoic acid |
|---|---|
| PubChem CID | 147961611 |
| Molecular Formula | C31H26ClNO6 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 4-[(3R)-3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4,4-dideuterio-2-oxo-4-(2,3,4,5,6-pentadeuteriophenyl)butyl]benzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])[C@H](C(=O)Cc2ccc(C(=O)O)cc2)n2cc(OC)c(-c3cc(Cl)ccc3C(C)=O)cc2=O)c([2H])c1[2H] |
| InChI | InChI=1S/C31H26ClNO6/c1-19(34)24-13-12-23(32)16-25(24)26-17-30(36)33(18-29(26)39-2)27(14-20-6-4-3-5-7-20)28(35)15-21-8-10-22(11-9-21)31(37)38/h3-13,16-18,27H,14-15H2,1-2H3,(H,37,38)/t27-/m1/s1/i3D,4D,5D,6D,7D,14D2 |
| InChIKey | IPPGMPPZINLRHP-AJKQLOHRSA-N |
| XLogP | 5.67 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |