C23H25BrN5O2+ — CID 147606060
5-bromo-3-[3-[2-(3-methylpiperazin-4-ium-1-yl)ethoxyimino]indol-2-yl]-1H-indol-2-ol (PubChem CID 147606060) has the molecular formula C23H25BrN5O2+ and a molecular weight of 483.39 g/mol. Its IUPAC name is 5-bromo-3-[3-[2-(3-methylpiperazin-4-ium-1-yl)ethoxyimino]indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[3-[2-(3-methylpiperazin-4-ium-1-yl)ethoxyimino]indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 147606060 |
| Molecular Formula | C23H25BrN5O2+ |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 5-bromo-3-[3-[2-(3-methylpiperazin-4-ium-1-yl)ethoxyimino]indol-2-yl]-1H-indol-2-ol |
| SMILES | CC1CN(CCON=C2C(c3c(O)[nH]c4ccc(Br)cc34)=Nc3ccccc32)CC[NH2+]1 |
| InChI | InChI=1S/C23H24BrN5O2/c1-14-13-29(9-8-25-14)10-11-31-28-21-16-4-2-3-5-18(16)26-22(21)20-17-12-15(24)6-7-19(17)27-23(20)30/h2-7,12,14,25,27,30H,8-11,13H2,1H3/p+1 |
| InChIKey | GZUYNUJLAFFNRI-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|