C16H24O3 — CID 14761625
1-(4-ethylphenyl)-2,2-dipropoxyethanone (PubChem CID 14761625) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2,2-dipropoxyethanone.
| Compound Name | 1-(4-ethylphenyl)-2,2-dipropoxyethanone |
|---|---|
| PubChem CID | 14761625 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-(4-ethylphenyl)-2,2-dipropoxyethanone |
| SMILES | CCCOC(OCCC)C(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C16H24O3/c1-4-11-18-16(19-12-5-2)15(17)14-9-7-13(6-3)8-10-14/h7-10,16H,4-6,11-12H2,1-3H3 |
| InChIKey | LZGCQYUCEGBUSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|