C18H12OSe2 — CID 147622675
6,16-dimethyl-11-oxa-7,15-diselenapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaene (PubChem CID 147622675) has the molecular formula C18H12OSe2 and a molecular weight of 402.21 g/mol. Its IUPAC name is 6,16-dimethyl-11-oxa-7,15-diselenapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaene.
| Compound Name | 6,16-dimethyl-11-oxa-7,15-diselenapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaene |
|---|---|
| PubChem CID | 147622675 |
| Molecular Formula | C18H12OSe2 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 6,16-dimethyl-11-oxa-7,15-diselenapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaene |
| SMILES | Cc1cc2cc3c(cc2[se]1)oc1cc2[se]c(C)cc2cc13 |
| InChI | InChI=1S/C18H12OSe2/c1-9-3-11-5-13-14-6-12-4-10(2)21-18(12)8-16(14)19-15(13)7-17(11)20-9/h3-8H,1-2H3 |
| InChIKey | GEEGJKSTDMCMHM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|