C11H6O3Se — CID 140822028
2-methylselenopheno[3,2-f][2]benzofuran-5,7-dione (PubChem CID 140822028) has the molecular formula C11H6O3Se and a molecular weight of 265.13 g/mol. Its IUPAC name is 2-methylselenopheno[3,2-f][2]benzofuran-5,7-dione.
| Compound Name | 2-methylselenopheno[3,2-f][2]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 140822028 |
| Molecular Formula | C11H6O3Se |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 2-methylselenopheno[3,2-f][2]benzofuran-5,7-dione |
| SMILES | Cc1cc2cc3c(cc2[se]1)C(=O)OC3=O |
| InChI | InChI=1S/C11H6O3Se/c1-5-2-6-3-7-8(4-9(6)15-5)11(13)14-10(7)12/h2-4H,1H3 |
| InChIKey | TZORLOODRINJLZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|