C10H6N2O3 — CID 54348365
2-methyl-3H-furo[3,4-f]benzimidazole-5,7-dione (PubChem CID 54348365) has the molecular formula C10H6N2O3 and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-methyl-3H-furo[3,4-f]benzimidazole-5,7-dione.
| Compound Name | 2-methyl-3H-furo[3,4-f]benzimidazole-5,7-dione |
|---|---|
| PubChem CID | 54348365 |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-methyl-3H-furo[3,4-f]benzimidazole-5,7-dione |
| SMILES | Cc1nc2cc3c(cc2[nH]1)C(=O)OC3=O |
| InChI | InChI=1S/C10H6N2O3/c1-4-11-7-2-5-6(3-8(7)12-4)10(14)15-9(5)13/h2-3H,1H3,(H,11,12) |
| InChIKey | UDXCWZGXVCGAIM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|