C26H28FN5O3S — CID 147627665
5-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 147627665) has the molecular formula C26H28FN5O3S and a molecular weight of 509.61 g/mol. Its IUPAC name is 5-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | 5-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 147627665 |
| Molecular Formula | C26H28FN5O3S |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 5-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | [C-]#[N+]c1ncc(N2C(=O)C3(CCC3)N(c3ccc(OCCCN4CCOCC4)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C26H28FN5O3S/c1-18-15-20(17-29-23(18)28-2)31-24(33)26(7-3-8-26)32(25(31)36)19-5-6-22(21(27)16-19)35-12-4-9-30-10-13-34-14-11-30/h5-6,15-17H,3-4,7-14H2,1H3 |
| InChIKey | GFCFSGGSKDKDDB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|