C29H30N6 — CID 147644608
4-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-5,6,7-trimethyl-2H-benzimidazole (PubChem CID 147644608) has the molecular formula C29H30N6 and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-5,6,7-trimethyl-2H-benzimidazole.
| Compound Name | 4-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-5,6,7-trimethyl-2H-benzimidazole |
|---|---|
| PubChem CID | 147644608 |
| Molecular Formula | C29H30N6 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-5,6,7-trimethyl-2H-benzimidazole |
| SMILES | Cc1cc(C(c2cc(C)c(C)c3c2=NCN=3)c2c(C)c(C)c(C)c3c2=NCN=3)c2c(c1C)=NCN=2 |
| InChI | InChI=1S/C29H30N6/c1-13-8-20(27-24(15(13)3)30-10-33-27)23(21-9-14(2)16(4)25-28(21)34-11-31-25)22-18(6)17(5)19(7)26-29(22)35-12-32-26/h8-9,23H,10-12H2,1-7H3 |
| InChIKey | JFCVUTUPIPVUSF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|