C27H28FN5O2 — CID 147672298
(6aR,7R,10aS)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 147672298) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 147672298 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (6aR,7R,10aS)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(N4CCN(C(C)=O)CC4)nc(-c4ccccc4F)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C27H28FN5O2/c1-16-20-10-9-19-23(18-7-5-6-8-21(18)28)30-26(33-13-11-32(12-14-33)17(2)34)31-25(19)27(20,3)15-22(29-4)24(16)35/h5-8,15-16,20H,9-14H2,1-3H3/t16-,20-,27-/m1/s1 |
| InChIKey | GNMAFCXUAGABPC-PJIRNLIGSA-N |
| XLogP | 3.79 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|