C23H37N4O11P — CID 147673454
propan-2-yl 2-[[[(2R,3R,6R,7S)-5-(2,4-dioxopyrimidin-1-yl)-6-hydroxy-7-(hydroxymethyl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate (PubChem CID 147673454) has the molecular formula C23H37N4O11P and a molecular weight of 576.54 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,6R,7S)-5-(2,4-dioxopyrimidin-1-yl)-6-hydroxy-7-(hydroxymethyl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,6R,7S)-5-(2,4-dioxopyrimidin-1-yl)-6-hydroxy-7-(hydroxymethyl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 147673454 |
| Molecular Formula | C23H37N4O11P |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,6R,7S)-5-(2,4-dioxopyrimidin-1-yl)-6-hydroxy-7-(hydroxymethyl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(NC(C)C(=O)OC(C)C)O[C@@H]1C[C@]12OC(n1ccc(=O)[nH]c1=O)[C@H](O)[C@@H]2CO |
| InChI | InChI=1S/C23H37N4O11P/c1-11(2)35-20(31)13(5)25-39(34,26-14(6)21(32)36-12(3)4)38-16-9-23(16)15(10-28)18(30)19(37-23)27-8-7-17(29)24-22(27)33/h7-8,11-16,18-19,28,30H,9-10H2,1-6H3,(H,24,29,33)(H2,25,26,34)/t13?,14?,15-,16+,18+,19?,23+,39?/m0/s1 |
| InChIKey | GNRODTIWVAETCL-YYBYPRQVSA-N |
| XLogP | -0.47 |
| TPSA | 207.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|