C24H30ClFN8O4 — CID 147675104
2-[5-chloro-2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4-fluorophenyl]propan-2-ol (PubChem CID 147675104) has the molecular formula C24H30ClFN8O4 and a molecular weight of 549.01 g/mol. Its IUPAC name is 2-[5-chloro-2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4-fluorophenyl]propan-2-ol.
| Compound Name | 2-[5-chloro-2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 147675104 |
| Molecular Formula | C24H30ClFN8O4 |
| Molecular Weight | 549.01 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[5-chloro-2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncnc(Nc2cc(F)c(Cl)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C24H30ClFN8O4/c1-24(2,35)14-9-15(25)16(26)10-17(14)29-22-27-13-28-23(31-22)30-18-11-20(34(36)37)19(12-21(18)38-6)33(5)8-7-32(3)4/h9-13,35H,7-8H2,1-6H3,(H2,27,28,29,30,31) |
| InChIKey | GNZXOZVCGOASTF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|