C9H16O5 — CID 14768490
(4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-one (PubChem CID 14768490) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-one.
| Compound Name | (4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 14768490 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-one |
| SMILES | COC[C@H]1OC(=O)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C9H16O5/c1-11-5-7-9(13-3)6(12-2)4-8(10)14-7/h6-7,9H,4-5H2,1-3H3/t6-,7-,9+/m1/s1 |
| InChIKey | KDCNRSFRNPEJTQ-BHNWBGBOSA-N |
| XLogP | -0.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |