C29H25NO3 — CID 147688075
1-[4-methoxy-3-[2-(3-methyl-4-pyridinyl)acetyl]phenyl]-2-(4-phenylphenyl)ethanone (PubChem CID 147688075) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[4-methoxy-3-[2-(3-methyl-4-pyridinyl)acetyl]phenyl]-2-(4-phenylphenyl)ethanone.
| Compound Name | 1-[4-methoxy-3-[2-(3-methyl-4-pyridinyl)acetyl]phenyl]-2-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 147688075 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[4-methoxy-3-[2-(3-methyl-4-pyridinyl)acetyl]phenyl]-2-(4-phenylphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2ccc(-c3ccccc3)cc2)cc1C(=O)Cc1ccncc1C |
| InChI | InChI=1S/C29H25NO3/c1-20-19-30-15-14-24(20)18-28(32)26-17-25(12-13-29(26)33-2)27(31)16-21-8-10-23(11-9-21)22-6-4-3-5-7-22/h3-15,17,19H,16,18H2,1-2H3 |
| InChIKey | GQKRXFLVCYFDIC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |