C17H20ClN5O3S — CID 147690618
4-amino-2-(3-chloropropylsulfonimidoyl)-7-[(4-methoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 147690618) has the molecular formula C17H20ClN5O3S and a molecular weight of 409.90 g/mol. Its IUPAC name is 4-amino-2-(3-chloropropylsulfonimidoyl)-7-[(4-methoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-(3-chloropropylsulfonimidoyl)-7-[(4-methoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 147690618 |
| Molecular Formula | C17H20ClN5O3S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-amino-2-(3-chloropropylsulfonimidoyl)-7-[(4-methoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | [H]N=S(=O)(CCCCl)c1nc(N)c2c(n1)N(Cc1ccc(OC)cc1)C(=O)C2 |
| InChI | InChI=1S/C17H20ClN5O3S/c1-26-12-5-3-11(4-6-12)10-23-14(24)9-13-15(19)21-17(22-16(13)23)27(20,25)8-2-7-18/h3-6,20H,2,7-10H2,1H3,(H2,19,21,22) |
| InChIKey | GQXDLWLXFZJZOE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|