C15H17ClN6O2S — CID 158131139
4-amino-7-[(6-chloro-3-pyridinyl)methyl]-2-(propylsulfonimidoyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 158131139) has the molecular formula C15H17ClN6O2S and a molecular weight of 380.86 g/mol. Its IUPAC name is 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-2-(propylsulfonimidoyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-2-(propylsulfonimidoyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 158131139 |
| Molecular Formula | C15H17ClN6O2S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-2-(propylsulfonimidoyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | [H]N=S(=O)(CCC)c1nc(N)c2c(n1)N(Cc1ccc(Cl)nc1)C(=O)C2 |
| InChI | InChI=1S/C15H17ClN6O2S/c1-2-5-25(18,24)15-20-13(17)10-6-12(23)22(14(10)21-15)8-9-3-4-11(16)19-7-9/h3-4,7,18H,2,5-6,8H2,1H3,(H2,17,20,21) |
| InChIKey | FSUDCSXQLWIMLN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|