C13H21N2O8P — CID 14769168
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 14769168) has the molecular formula C13H21N2O8P and a molecular weight of 364.29 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 14769168 |
| Molecular Formula | C13H21N2O8P |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OC(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O8P/c1-7(2)23-24(19,20)21-6-10-9(16)4-11(22-10)15-5-8(3)12(17)14-13(15)18/h5,7,9-11,16H,4,6H2,1-3H3,(H,19,20)(H,14,17,18)/t9-,10+,11+/m0/s1 |
| InChIKey | MQNNGQSRHBIACH-HBNTYKKESA-N |
| XLogP | 0.04 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|