C33H41F3IrNO2- — CID 147701210
2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4,4,4-trifluoro-3-methylbutyl)quinoline;6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium (PubChem CID 147701210) has the molecular formula C33H41F3IrNO2- and a molecular weight of 732.91 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4,4,4-trifluoro-3-methylbutyl)quinoline;6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4,4,4-trifluoro-3-methylbutyl)quinoline;6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 147701210 |
| Molecular Formula | C33H41F3IrNO2- |
| Molecular Weight | 732.91 g/mol |
| Exact Mass | 733.27 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4,4,4-trifluoro-3-methylbutyl)quinoline;6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)C(=O)C=C(O)C(C)CC.Cc1[c-]c(-c2ccc3c(CCC(C)C(F)(F)F)cccc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C22H21F3N.C11H20O2.Ir/c1-14-11-15(2)13-18(12-14)20-10-9-19-17(5-4-6-21(19)26-20)8-7-16(3)22(23,24)25;1-5-8(3)10(12)7-11(13)9(4)6-2;/h4-6,9-12,16H,7-8H2,1-3H3;7-9,12H,5-6H2,1-4H3;/q-1;; |
| InChIKey | JCWKHXPIEIQFFU-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.91 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|