C36H27F7IrNO2- — CID 59859350
2-[9-(1,1,2,2,3,3,3-heptafluoropropyl)-9-phenyl-3H-fluoren-3-id-2-yl]quinoline;4-hydroxypentan-2-one;iridium (PubChem CID 59859350) has the molecular formula C36H27F7IrNO2- and a molecular weight of 830.82 g/mol. Its IUPAC name is 2-[9-(1,1,2,2,3,3,3-heptafluoropropyl)-9-phenyl-3H-fluoren-3-id-2-yl]quinoline;4-hydroxypentan-2-one;iridium.
| Compound Name | 2-[9-(1,1,2,2,3,3,3-heptafluoropropyl)-9-phenyl-3H-fluoren-3-id-2-yl]quinoline;4-hydroxypentan-2-one;iridium |
|---|---|
| PubChem CID | 59859350 |
| Molecular Formula | C36H27F7IrNO2- |
| Molecular Weight | 830.82 g/mol |
| Exact Mass | 831.16 |
| IUPAC Name | 2-[9-(1,1,2,2,3,3,3-heptafluoropropyl)-9-phenyl-3H-fluoren-3-id-2-yl]quinoline;4-hydroxypentan-2-one;iridium |
| SMILES | CC(=O)CC(C)O.FC(F)(F)C(F)(F)C(F)(F)C1(c2ccccc2)c2ccccc2-c2c[c-]c(-c3ccc4ccccc4n3)cc21.[Ir] |
| InChI | InChI=1S/C31H17F7N.C5H10O2.Ir/c32-29(33,30(34,35)31(36,37)38)28(21-9-2-1-3-10-21)24-12-6-5-11-22(24)23-16-14-20(18-25(23)28)27-17-15-19-8-4-7-13-26(19)39-27;1-4(6)3-5(2)7;/h1-13,15-18H;4,6H,3H2,1-2H3;/q-1;; |
| InChIKey | JFIBOLXDSSBKLN-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.82 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|