C30H26F3IrNO2 — CID 59859358
2-[9,9-dimethyl-7-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 59859358) has the molecular formula C30H26F3IrNO2 and a molecular weight of 681.75 g/mol. Its IUPAC name is 2-[9,9-dimethyl-7-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 2-[9,9-dimethyl-7-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 59859358 |
| Molecular Formula | C30H26F3IrNO2 |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | 2-[9,9-dimethyl-7-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | CC1(C)c2cc(-c3ccc4ccccc4n3)[c-]cc2-c2ccc(C(F)(F)F)cc21.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C25H17F3N.C5H8O2.Ir/c1-24(2)20-13-16(23-12-8-15-5-3-4-6-22(15)29-23)7-10-18(20)19-11-9-17(14-21(19)24)25(26,27)28;1-4(6)3-5(2)7;/h3-6,8-14H,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | VKVCNLDLTJCREU-LWFKIUJUSA-O |
| XLogP | 8.04 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|