C30H16F6IrN- — CID 59859319
iridium;2-[9-phenyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline (PubChem CID 59859319) has the molecular formula C30H16F6IrN- and a molecular weight of 696.67 g/mol. Its IUPAC name is iridium;2-[9-phenyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline.
| Compound Name | iridium;2-[9-phenyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
|---|---|
| PubChem CID | 59859319 |
| Molecular Formula | C30H16F6IrN- |
| Molecular Weight | 696.67 g/mol |
| Exact Mass | 697.08 |
| IUPAC Name | iridium;2-[9-phenyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)C(c1ccccc1)(C(F)(F)F)c1cc(-c3ccc4ccccc4n3)[c-]cc1-2.[Ir] |
| InChI | InChI=1S/C30H16F6N.Ir/c31-29(32,33)21-12-14-23-22-13-10-19(27-15-11-18-6-4-5-9-26(18)37-27)16-24(22)28(25(23)17-21,30(34,35)36)20-7-2-1-3-8-20;/h1-9,11-17H;/q-1; |
| InChIKey | SUNDPRUAKBMWFS-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.67 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|