C29H25F3IrNO2- — CID 59859354
4-hydroxypentan-2-one;iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline (PubChem CID 59859354) has the molecular formula C29H25F3IrNO2- and a molecular weight of 668.74 g/mol. Its IUPAC name is 4-hydroxypentan-2-one;iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline.
| Compound Name | 4-hydroxypentan-2-one;iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
|---|---|
| PubChem CID | 59859354 |
| Molecular Formula | C29H25F3IrNO2- |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | 4-hydroxypentan-2-one;iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
| SMILES | CC(=O)CC(C)O.CC1(C(F)(F)F)c2ccccc2-c2c[c-]c(-c3ccc4ccccc4n3)cc21.[Ir] |
| InChI | InChI=1S/C24H15F3N.C5H10O2.Ir/c1-23(24(25,26)27)19-8-4-3-7-17(19)18-12-10-16(14-20(18)23)22-13-11-15-6-2-5-9-21(15)28-22;1-4(6)3-5(2)7;/h2-9,11-14H,1H3;4,6H,3H2,1-2H3;/q-1;; |
| InChIKey | MVRVLPBCLHLASC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|