C38H35N5O5 — CID 147707935
2-[5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-2-pyridinyl]-1-(4-phenylquinazolin-2-yl)ethanone (PubChem CID 147707935) has the molecular formula C38H35N5O5 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-[5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-2-pyridinyl]-1-(4-phenylquinazolin-2-yl)ethanone.
| Compound Name | 2-[5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-2-pyridinyl]-1-(4-phenylquinazolin-2-yl)ethanone |
|---|---|
| PubChem CID | 147707935 |
| Molecular Formula | C38H35N5O5 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 2-[5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-2-pyridinyl]-1-(4-phenylquinazolin-2-yl)ethanone |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)c4nc(-c5ccccc5)c5ccccc5n4)nc3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C38H35N5O5/c1-45-35-23-30-32(24-36(35)47-19-7-16-43-17-20-46-21-18-43)39-15-14-34(30)48-28-13-12-27(40-25-28)22-33(44)38-41-31-11-6-5-10-29(31)37(42-38)26-8-3-2-4-9-26/h2-6,8-15,23-25H,7,16-22H2,1H3 |
| InChIKey | GUDJYSKHHMJGIH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 108.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|