C27H34BrN3O4 — CID 147709041
ethyl (3S)-6-[[3-(2-amino-2-iminoethyl)benzoyl]amino]-3-(3-bromo-5-tert-butylphenyl)-5-oxohexanoate (PubChem CID 147709041) has the molecular formula C27H34BrN3O4 and a molecular weight of 544.49 g/mol. Its IUPAC name is ethyl (3S)-6-[[3-(2-amino-2-iminoethyl)benzoyl]amino]-3-(3-bromo-5-tert-butylphenyl)-5-oxohexanoate.
| Compound Name | ethyl (3S)-6-[[3-(2-amino-2-iminoethyl)benzoyl]amino]-3-(3-bromo-5-tert-butylphenyl)-5-oxohexanoate |
|---|---|
| PubChem CID | 147709041 |
| Molecular Formula | C27H34BrN3O4 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | ethyl (3S)-6-[[3-(2-amino-2-iminoethyl)benzoyl]amino]-3-(3-bromo-5-tert-butylphenyl)-5-oxohexanoate |
| SMILES | [H]/N=C(\N)Cc1cccc(C(=O)NCC(=O)C[C@@H](CC(=O)OCC)c2cc(Br)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C27H34BrN3O4/c1-5-35-25(33)14-20(19-11-21(27(2,3)4)15-22(28)12-19)13-23(32)16-31-26(34)18-8-6-7-17(9-18)10-24(29)30/h6-9,11-12,15,20H,5,10,13-14,16H2,1-4H3,(H3,29,30)(H,31,34)/t20-/m0/s1 |
| InChIKey | GUIPIROIKCQLAF-FQEVSTJZSA-N |
| XLogP | 4.65 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|