About 9H-fluoren-2-ylthiourea
9H-fluoren-2-ylthiourea (PubChem CID 1477129) has the molecular formula C14H12N2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 9H-fluoren-2-ylthiourea.
Molecular Properties
| Compound Name | 9H-fluoren-2-ylthiourea |
| PubChem CID | 1477129 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 9H-fluoren-2-ylthiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H12N2S/c15-14(17)16-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2,(H3,15,16,17) |
| InChIKey | CVQDYBYEKHWWCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-2-ylthiourea?
The IUPAC name of 9H-fluoren-2-ylthiourea (CID 1477129) is 9H-fluoren-2-ylthiourea.
What is the SMILES notation for 9H-fluoren-2-ylthiourea?
The canonical SMILES for 9H-fluoren-2-ylthiourea is NC(=S)Nc1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluoren-2-ylthiourea?
The InChIKey is CVQDYBYEKHWWCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2S/c15-14(17)16-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2,(H3,15,16,17).
What are the key properties of 9H-fluoren-2-ylthiourea?
9H-fluoren-2-ylthiourea has a molecular weight of 240.33 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-2-ylthiourea is sourced from PubChem (CID 1477129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).