C17H24IN3 — CID 14771727
1-(2-iodophenyl)-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]guanidine (PubChem CID 14771727) has the molecular formula C17H24IN3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 1-(2-iodophenyl)-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]guanidine.
| Compound Name | 1-(2-iodophenyl)-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]guanidine |
|---|---|
| PubChem CID | 14771727 |
| Molecular Formula | C17H24IN3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-(2-iodophenyl)-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]guanidine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](/N=C(\N)Nc1ccccc1I)C2 |
| InChI | InChI=1S/C17H24IN3/c1-16(2)11-8-9-17(16,3)14(10-11)21-15(19)20-13-7-5-4-6-12(13)18/h4-7,11,14H,8-10H2,1-3H3,(H3,19,20,21)/t11-,14-,17+/m1/s1 |
| InChIKey | IHGPGLBRYYVGAG-ZLENFMNRSA-N |
| XLogP | 4.23 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|