C15H9Cl3F3NO — CID 14772556
2,3,6-trichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 14772556) has the molecular formula C15H9Cl3F3NO and a molecular weight of 382.60 g/mol. Its IUPAC name is 2,3,6-trichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2,3,6-trichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 14772556 |
| Molecular Formula | C15H9Cl3F3NO |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,3,6-trichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C15H9Cl3F3NO/c16-10-5-6-11(17)13(18)12(10)14(23)22-7-8-1-3-9(4-2-8)15(19,20)21/h1-6H,7H2,(H,22,23) |
| InChIKey | YPSIJZCVKABTQE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|