C15H20ClFN2O3 — CID 147757104
tert-butyl (1S)-1-(aminomethyl)-5-chloro-7-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 147757104) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is tert-butyl (1S)-1-(aminomethyl)-5-chloro-7-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1S)-1-(aminomethyl)-5-chloro-7-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 147757104 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | tert-butyl (1S)-1-(aminomethyl)-5-chloro-7-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(Cl)cc(F)c(O)c2[C@H]1CN |
| InChI | InChI=1S/C15H20ClFN2O3/c1-15(2,3)22-14(21)19-5-4-8-9(16)6-10(17)13(20)12(8)11(19)7-18/h6,11,20H,4-5,7,18H2,1-3H3/t11-/m1/s1 |
| InChIKey | HDIKMTMLVQATQW-LLVKDONJSA-N |
| XLogP | 2.98 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|