C15H18F3NO3 — CID 175848311
tert-butyl 1-(difluoromethyl)-5-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 175848311) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is tert-butyl 1-(difluoromethyl)-5-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-(difluoromethyl)-5-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 175848311 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | tert-butyl 1-(difluoromethyl)-5-fluoro-8-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(F)ccc(O)c2C1C(F)F |
| InChI | InChI=1S/C15H18F3NO3/c1-15(2,3)22-14(21)19-7-6-8-9(16)4-5-10(20)11(8)12(19)13(17)18/h4-5,12-13,20H,6-7H2,1-3H3 |
| InChIKey | IORLAIWYZUEPHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|