C17H23NO5 — CID 172790588
tert-butyl 8-hydroxy-1-(2-hydroxypropanoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 172790588) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is tert-butyl 8-hydroxy-1-(2-hydroxypropanoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 8-hydroxy-1-(2-hydroxypropanoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 172790588 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tert-butyl 8-hydroxy-1-(2-hydroxypropanoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(O)C(=O)C1c2c(O)cccc2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO5/c1-10(19)15(21)14-13-11(6-5-7-12(13)20)8-9-18(14)16(22)23-17(2,3)4/h5-7,10,14,19-20H,8-9H2,1-4H3 |
| InChIKey | PNANWFPLGCFKNH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|