C17H20N2O4 — CID 172750343
tert-butyl 8-hydroxy-1-(1,3-oxazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 172750343) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl 8-hydroxy-1-(1,3-oxazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 8-hydroxy-1-(1,3-oxazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 172750343 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl 8-hydroxy-1-(1,3-oxazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cccc(O)c2C1c1ncco1 |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,3)23-16(21)19-9-7-11-5-4-6-12(20)13(11)14(19)15-18-8-10-22-15/h4-6,8,10,14,20H,7,9H2,1-3H3 |
| InChIKey | KHAGRPWIQXDPGP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|